About (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine
(3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine (PubChem CID 135270899) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine |
| PubChem CID | 135270899 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine |
| SMILES | C=NC(=C)/C(=C\CCC)N(C)CC |
| InChI | InChI=1S/C11H20N2/c1-6-8-9-11(10(3)12-4)13(5)7-2/h9H,3-4,6-8H2,1-2,5H3/b11-9+ |
| InChIKey | HIOMNIRUBTXOKJ-PKNBQFBNSA-N |
| XLogP | 2.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine?
The IUPAC name of (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine (CID 135270899) is (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine.
What is the SMILES notation for (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine?
The canonical SMILES for (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine is C=NC(=C)/C(=C\CCC)N(C)CC.
What is the InChIKey of (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine?
The InChIKey is HIOMNIRUBTXOKJ-PKNBQFBNSA-N. The full InChI is InChI=1S/C11H20N2/c1-6-8-9-11(10(3)12-4)13(5)7-2/h9H,3-4,6-8H2,1-2,5H3/b11-9+.
What are the key properties of (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine?
(3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine has a molecular weight of 180.29 g/mol, XLogP of 2.84, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-ethyl-N-methyl-2-(methylideneamino)hepta-1,3-dien-3-amine is sourced from PubChem (CID 135270899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).