About 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde
7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde (PubChem CID 135270965) has the molecular formula C10H7BrO2
and a molecular weight of 239.07 g/mol. Its IUPAC name is 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde.
Molecular Properties
| Compound Name | 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde |
| PubChem CID | 135270965 |
| Molecular Formula | C10H7BrO2 |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde |
| SMILES | O=Cc1ccc(Br)c2c1CCC2=O |
| InChI | InChI=1S/C10H7BrO2/c11-8-3-1-6(5-12)7-2-4-9(13)10(7)8/h1,3,5H,2,4H2 |
| InChIKey | GNKXAEZWQJFJIT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde?
The IUPAC name of 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde (CID 135270965) is 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde.
What is the SMILES notation for 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde?
The canonical SMILES for 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde is O=Cc1ccc(Br)c2c1CCC2=O.
What is the InChIKey of 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde?
The InChIKey is GNKXAEZWQJFJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO2/c11-8-3-1-6(5-12)7-2-4-9(13)10(7)8/h1,3,5H,2,4H2.
What are the key properties of 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde?
7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde has a molecular weight of 239.07 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-oxo-2,3-dihydroindene-4-carbaldehyde is sourced from PubChem (CID 135270965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).