C13H24N4 — CID 135271003
4-N,5-dibutyl-6-methylpyrimidine-2,4-diamine (PubChem CID 135271003) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-N,5-dibutyl-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N,5-dibutyl-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 135271003 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 4-N,5-dibutyl-6-methylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc(C)c1CCCC |
| InChI | InChI=1S/C13H24N4/c1-4-6-8-11-10(3)16-13(14)17-12(11)15-9-7-5-2/h4-9H2,1-3H3,(H3,14,15,16,17) |
| InChIKey | WSTNWJZVMKIDIY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|