C14H23N7 — CID 135271031
4-N-butyl-6-methyl-5-[3-(1,2,4-triazol-1-yl)propyl]pyrimidine-2,4-diamine (PubChem CID 135271031) has the molecular formula C14H23N7 and a molecular weight of 289.39 g/mol. Its IUPAC name is 4-N-butyl-6-methyl-5-[3-(1,2,4-triazol-1-yl)propyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-methyl-5-[3-(1,2,4-triazol-1-yl)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 135271031 |
| Molecular Formula | C14H23N7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-N-butyl-6-methyl-5-[3-(1,2,4-triazol-1-yl)propyl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc(C)c1CCCn1cncn1 |
| InChI | InChI=1S/C14H23N7/c1-3-4-7-17-13-12(11(2)19-14(15)20-13)6-5-8-21-10-16-9-18-21/h9-10H,3-8H2,1-2H3,(H3,15,17,19,20) |
| InChIKey | DANRWCWGDHTZPU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|