C21H38N6O2 — CID 135271035
tert-butyl 4-[3-[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]propyl]piperazine-1-carboxylate (PubChem CID 135271035) has the molecular formula C21H38N6O2 and a molecular weight of 406.58 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 135271035 |
| Molecular Formula | C21H38N6O2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | tert-butyl 4-[3-[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]propyl]piperazine-1-carboxylate |
| SMILES | CCCCNc1nc(N)nc(C)c1CCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H38N6O2/c1-6-7-10-23-18-17(16(2)24-19(22)25-18)9-8-11-26-12-14-27(15-13-26)20(28)29-21(3,4)5/h6-15H2,1-5H3,(H3,22,23,24,25) |
| InChIKey | KTLFBJNYAJVUJC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|