C30H28N6O4S4 — CID 135271168
5-hexyl-2-[8-(5-hexyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 135271168) has the molecular formula C30H28N6O4S4 and a molecular weight of 664.86 g/mol. Its IUPAC name is 5-hexyl-2-[8-(5-hexyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 5-hexyl-2-[8-(5-hexyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 135271168 |
| Molecular Formula | C30H28N6O4S4 |
| Molecular Weight | 664.86 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | 5-hexyl-2-[8-(5-hexyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CCCCCCN1C(=O)c2cc(-c3c4c(c(-c5cc6c(s5)C(=O)N(CCCCCC)C6=O)c5nsnc35)N=S=N4)sc2C1=O |
| InChI | InChI=1S/C30H28N6O4S4/c1-3-5-7-9-11-35-27(37)15-13-17(41-25(15)29(35)39)19-21-23(33-43-31-21)20(24-22(19)32-44-34-24)18-14-16-26(42-18)30(40)36(28(16)38)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | WFZJTCXTEXMFEZ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 125.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.86 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|