C34H36N6O4S4 — CID 135271174
5-octyl-2-[8-(5-octyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 135271174) has the molecular formula C34H36N6O4S4 and a molecular weight of 720.97 g/mol. Its IUPAC name is 5-octyl-2-[8-(5-octyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 5-octyl-2-[8-(5-octyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 135271174 |
| Molecular Formula | C34H36N6O4S4 |
| Molecular Weight | 720.97 g/mol |
| Exact Mass | 720.17 |
| IUPAC Name | 5-octyl-2-[8-(5-octyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCN1C(=O)c2cc(-c3c4c(c(-c5cc6c(s5)C(=O)N(CCCCCCCC)C6=O)c5nsnc35)N=S=N4)sc2C1=O |
| InChI | InChI=1S/C34H36N6O4S4/c1-3-5-7-9-11-13-15-39-31(41)19-17-21(45-29(19)33(39)43)23-25-27(37-47-35-25)24(28-26(23)36-48-38-28)22-18-20-30(46-22)34(44)40(32(20)42)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | UHHHBBHJTDKERL-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 125.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.97 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|