C20H8N6O4S4 — CID 135271191
5-methyl-2-[8-(5-methyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 135271191) has the molecular formula C20H8N6O4S4 and a molecular weight of 524.59 g/mol. Its IUPAC name is 5-methyl-2-[8-(5-methyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 5-methyl-2-[8-(5-methyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 135271191 |
| Molecular Formula | C20H8N6O4S4 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | 5-methyl-2-[8-(5-methyl-4,6-dioxothieno[2,3-c]pyrrol-2-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaen-2-yl]thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CN1C(=O)c2cc(-c3c4c(c(-c5cc6c(s5)C(=O)N(C)C6=O)c5nsnc35)N=S=N4)sc2C1=O |
| InChI | InChI=1S/C20H8N6O4S4/c1-25-17(27)5-3-7(31-15(5)19(25)29)9-11-13(23-33-21-11)10(14-12(9)22-34-24-14)8-4-6-16(32-8)20(30)26(2)18(6)28/h3-4H,1-2H3 |
| InChIKey | NVTADEQATYYRJG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 125.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|