C25H29FN8O3S — CID 135271417
6-[[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]methyl]-N-(3-fluoro-4-pyridinyl)-2-(6-methoxy-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 135271417) has the molecular formula C25H29FN8O3S and a molecular weight of 540.63 g/mol. Its IUPAC name is 6-[[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]methyl]-N-(3-fluoro-4-pyridinyl)-2-(6-methoxy-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 6-[[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]methyl]-N-(3-fluoro-4-pyridinyl)-2-(6-methoxy-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 135271417 |
| Molecular Formula | C25H29FN8O3S |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 6-[[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]methyl]-N-(3-fluoro-4-pyridinyl)-2-(6-methoxy-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | COc1cccc(-c2nc(Nc3ccncc3F)c3cc(CNCCCN4CCS(=O)(=O)CC4)cn3n2)n1 |
| InChI | InChI=1S/C25H29FN8O3S/c1-37-23-5-2-4-21(29-23)24-31-25(30-20-6-8-28-16-19(20)26)22-14-18(17-34(22)32-24)15-27-7-3-9-33-10-12-38(35,36)13-11-33/h2,4-6,8,14,16-17,27H,3,7,9-13,15H2,1H3,(H,28,30,31,32) |
| InChIKey | NABHONMKXUZTJE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|