About N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine
N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine (PubChem CID 135271646) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine.
Molecular Properties
| Compound Name | N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine |
| PubChem CID | 135271646 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine |
| SMILES | C=C(CCC(=C)C(=C)C(C)C)NO |
| InChI | InChI=1S/C11H19NO/c1-8(2)11(5)9(3)6-7-10(4)12-13/h8,12-13H,3-7H2,1-2H3 |
| InChIKey | WVTCCSXVTTXFJC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine?
The IUPAC name of N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine (CID 135271646) is N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine.
What is the SMILES notation for N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine?
The canonical SMILES for N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine is C=C(CCC(=C)C(=C)C(C)C)NO.
What is the InChIKey of N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine?
The InChIKey is WVTCCSXVTTXFJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-8(2)11(5)9(3)6-7-10(4)12-13/h8,12-13H,3-7H2,1-2H3.
What are the key properties of N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine?
N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine has a molecular weight of 181.28 g/mol, XLogP of 3.03, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-methyl-5,6-dimethylideneoct-1-en-2-yl)hydroxylamine is sourced from PubChem (CID 135271646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).