C14H24O2 — CID 135272616
(8aR)-4a-ethyl-2,8,8-trimethyl-2,3,4,5,6,8a-hexahydrochromen-7-one (PubChem CID 135272616) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (8aR)-4a-ethyl-2,8,8-trimethyl-2,3,4,5,6,8a-hexahydrochromen-7-one.
| Compound Name | (8aR)-4a-ethyl-2,8,8-trimethyl-2,3,4,5,6,8a-hexahydrochromen-7-one |
|---|---|
| PubChem CID | 135272616 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (8aR)-4a-ethyl-2,8,8-trimethyl-2,3,4,5,6,8a-hexahydrochromen-7-one |
| SMILES | CCC12CCC(=O)C(C)(C)[C@@H]1OC(C)CC2 |
| InChI | InChI=1S/C14H24O2/c1-5-14-8-6-10(2)16-12(14)13(3,4)11(15)7-9-14/h10,12H,5-9H2,1-4H3/t10?,12-,14?/m0/s1 |
| InChIKey | WBCUYZLYTXHNLP-KHJSKFAYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |