C22H34N4O7 — CID 135272675
tert-butyl (2S)-2-[[(2S)-2-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexanoyl]amino]propanoyl]amino]propanoate (PubChem CID 135272675) has the molecular formula C22H34N4O7 and a molecular weight of 466.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 135272675 |
| Molecular Formula | C22H34N4O7 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexanoyl]amino]propanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)CCCCC(=O)NCCN1C(=O)C=CC1=O)C(=O)N[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H34N4O7/c1-14(20(31)25-15(2)21(32)33-22(3,4)5)24-17(28)9-7-6-8-16(27)23-12-13-26-18(29)10-11-19(26)30/h10-11,14-15H,6-9,12-13H2,1-5H3,(H,23,27)(H,24,28)(H,25,31)/t14-,15-/m0/s1 |
| InChIKey | HRSCPXATZFOTTO-GJZGRUSLSA-N |
| XLogP | -0.06 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|