About 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine
1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine (PubChem CID 135273179) has the molecular formula C20H39FN2
and a molecular weight of 326.54 g/mol. Its IUPAC name is 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine.
Molecular Properties
| Compound Name | 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine |
| PubChem CID | 135273179 |
| Molecular Formula | C20H39FN2 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 326.31 |
| IUPAC Name | 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine |
| SMILES | CC(C)(C)CC1CCC(F)(CN2CCN(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H39FN2/c1-18(2,3)15-17-7-9-20(21,10-8-17)16-22-11-13-23(14-12-22)19(4,5)6/h17H,7-16H2,1-6H3 |
| InChIKey | HSFFWKDXNNCORH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine?
The IUPAC name of 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine (CID 135273179) is 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine.
What is the SMILES notation for 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine?
The canonical SMILES for 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine is CC(C)(C)CC1CCC(F)(CN2CCN(C(C)(C)C)CC2)CC1.
What is the InChIKey of 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine?
The InChIKey is HSFFWKDXNNCORH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39FN2/c1-18(2,3)15-17-7-9-20(21,10-8-17)16-22-11-13-23(14-12-22)19(4,5)6/h17H,7-16H2,1-6H3.
What are the key properties of 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine?
1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine has a molecular weight of 326.54 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-[[4-(2,2-dimethylpropyl)-1-fluorocyclohexyl]methyl]piperazine is sourced from PubChem (CID 135273179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).