C27H37F3N2O5 — CID 135273387
(4S,7R,8S,9S,10E,13E,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(5-methyl-1,2-oxazol-3-yl)prop-1-en-2-yl]-13-(trifluoromethyl)-1-azacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 135273387) has the molecular formula C27H37F3N2O5 and a molecular weight of 526.60 g/mol. Its IUPAC name is (4S,7R,8S,9S,10E,13E,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(5-methyl-1,2-oxazol-3-yl)prop-1-en-2-yl]-13-(trifluoromethyl)-1-azacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10E,13E,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(5-methyl-1,2-oxazol-3-yl)prop-1-en-2-yl]-13-(trifluoromethyl)-1-azacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 135273387 |
| Molecular Formula | C27H37F3N2O5 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | (4S,7R,8S,9S,10E,13E,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[(E)-1-(5-methyl-1,2-oxazol-3-yl)prop-1-en-2-yl]-13-(trifluoromethyl)-1-azacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | C/C(=C\c1cc(C)on1)[C@@H]1C/C=C(/C(F)(F)F)C/C=C/[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C27H37F3N2O5/c1-15-8-7-9-19(27(28,29)30)10-11-21(16(2)12-20-13-17(3)37-32-20)31-23(34)14-22(33)26(5,6)25(36)18(4)24(15)35/h7-8,10,12-13,15,18,21-22,24,33,35H,9,11,14H2,1-6H3,(H,31,34)/b8-7+,16-12+,19-10+/t15-,18+,21-,22-,24-/m0/s1 |
| InChIKey | CIGXUJUVYKBFAF-PHNYORQKSA-N |
| XLogP | 4.69 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|