C27H35FN6 — CID 135273837
6-N-[5-(1-but-3-enyl-3-fluoropiperidin-4-yl)-2-methanimidoyl-4-methylphenyl]-4-N-cyclopent-2-en-1-yl-2-methylpyrimidine-4,6-diamine (PubChem CID 135273837) has the molecular formula C27H35FN6 and a molecular weight of 462.62 g/mol. Its IUPAC name is 6-N-[5-(1-but-3-enyl-3-fluoropiperidin-4-yl)-2-methanimidoyl-4-methylphenyl]-4-N-cyclopent-2-en-1-yl-2-methylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[5-(1-but-3-enyl-3-fluoropiperidin-4-yl)-2-methanimidoyl-4-methylphenyl]-4-N-cyclopent-2-en-1-yl-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 135273837 |
| Molecular Formula | C27H35FN6 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 6-N-[5-(1-but-3-enyl-3-fluoropiperidin-4-yl)-2-methanimidoyl-4-methylphenyl]-4-N-cyclopent-2-en-1-yl-2-methylpyrimidine-4,6-diamine |
| SMILES | [H]/N=C/c1cc(C)c(C2CCN(CCC=C)CC2F)cc1Nc1cc(NC2C=CCC2)nc(C)n1 |
| InChI | InChI=1S/C27H35FN6/c1-4-5-11-34-12-10-22(24(28)17-34)23-14-25(20(16-29)13-18(23)2)33-27-15-26(30-19(3)31-27)32-21-8-6-7-9-21/h4,6,8,13-16,21-22,24,29H,1,5,7,9-12,17H2,2-3H3,(H2,30,31,32,33)/b29-16+ |
| InChIKey | FMMAZLZCBRHYBF-MUFRIFMGSA-N |
| XLogP | 5.67 |
| TPSA | 76.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|