C25H54N2 — CID 135274412
N,N,N',N'-tetrakis(4-methylpentyl)methanediamine (PubChem CID 135274412) has the molecular formula C25H54N2 and a molecular weight of 382.72 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(4-methylpentyl)methanediamine.
| Compound Name | N,N,N',N'-tetrakis(4-methylpentyl)methanediamine |
|---|---|
| PubChem CID | 135274412 |
| Molecular Formula | C25H54N2 |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 382.43 |
| IUPAC Name | N,N,N',N'-tetrakis(4-methylpentyl)methanediamine |
| SMILES | CC(C)CCCN(CCCC(C)C)CN(CCCC(C)C)CCCC(C)C |
| InChI | InChI=1S/C25H54N2/c1-22(2)13-9-17-26(18-10-14-23(3)4)21-27(19-11-15-24(5)6)20-12-16-25(7)8/h22-25H,9-21H2,1-8H3 |
| InChIKey | KTMPKJBFTLWXKK-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|