C24H42F8O20 — CID 135274590
[1-[3,4-bis[2,3-bis(2-fluorooxyethoxy)propoxy]-1-[2,3-bis(fluoroperoxy)propoxy]butan-2-yl]oxy-3-fluoroperoxypropan-2-yl]oxy hypofluorite (PubChem CID 135274590) has the molecular formula C24H42F8O20 and a molecular weight of 802.56 g/mol. Its IUPAC name is [1-[3,4-bis[2,3-bis(2-fluorooxyethoxy)propoxy]-1-[2,3-bis(fluoroperoxy)propoxy]butan-2-yl]oxy-3-fluoroperoxypropan-2-yl]oxy hypofluorite.
| Compound Name | [1-[3,4-bis[2,3-bis(2-fluorooxyethoxy)propoxy]-1-[2,3-bis(fluoroperoxy)propoxy]butan-2-yl]oxy-3-fluoroperoxypropan-2-yl]oxy hypofluorite |
|---|---|
| PubChem CID | 135274590 |
| Molecular Formula | C24H42F8O20 |
| Molecular Weight | 802.56 g/mol |
| Exact Mass | 802.21 |
| IUPAC Name | [1-[3,4-bis[2,3-bis(2-fluorooxyethoxy)propoxy]-1-[2,3-bis(fluoroperoxy)propoxy]butan-2-yl]oxy-3-fluoroperoxypropan-2-yl]oxy hypofluorite |
| SMILES | FOCCOCC(COCC(OCC(COCCOF)OCCOF)C(COCC(COOF)OOF)OCC(COOF)OOF)OCCOF |
| InChI | InChI=1S/C24H42F8O20/c25-41-5-1-33-9-19(37-3-7-43-27)11-35-17-23(39-13-20(38-4-8-44-28)10-34-2-6-42-26)24(40-14-22(48-52-32)16-46-50-30)18-36-12-21(47-51-31)15-45-49-29/h19-24H,1-18H2 |
| InChIKey | QJCVUUXVYTYGND-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 184.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|