C26H46F8O21 — CID 135274633
[2-[2-[1,3-bis[1,3-bis(2-fluorooxyethoxy)propan-2-yloxy]propan-2-yloxy]-3-[1,3-bis(fluoroperoxy)propan-2-yloxy]propoxy]-3-fluoroperoxypropoxy] hypofluorite (PubChem CID 135274633) has the molecular formula C26H46F8O21 and a molecular weight of 846.62 g/mol. Its IUPAC name is [2-[2-[1,3-bis[1,3-bis(2-fluorooxyethoxy)propan-2-yloxy]propan-2-yloxy]-3-[1,3-bis(fluoroperoxy)propan-2-yloxy]propoxy]-3-fluoroperoxypropoxy] hypofluorite.
| Compound Name | [2-[2-[1,3-bis[1,3-bis(2-fluorooxyethoxy)propan-2-yloxy]propan-2-yloxy]-3-[1,3-bis(fluoroperoxy)propan-2-yloxy]propoxy]-3-fluoroperoxypropoxy] hypofluorite |
|---|---|
| PubChem CID | 135274633 |
| Molecular Formula | C26H46F8O21 |
| Molecular Weight | 846.62 g/mol |
| Exact Mass | 846.24 |
| IUPAC Name | [2-[2-[1,3-bis[1,3-bis(2-fluorooxyethoxy)propan-2-yloxy]propan-2-yloxy]-3-[1,3-bis(fluoroperoxy)propan-2-yloxy]propoxy]-3-fluoroperoxypropoxy] hypofluorite |
| SMILES | FOCCOCC(COCCOF)OCC(COC(COCCOF)COCCOF)OC(COC(COOF)COOF)COC(COOF)COOF |
| InChI | InChI=1S/C26H46F8O21/c27-43-5-1-35-9-21(10-36-2-6-44-28)39-13-25(14-40-22(11-37-3-7-45-29)12-38-4-8-46-30)51-26(15-41-23(17-47-52-31)18-48-53-32)16-42-24(19-49-54-33)20-50-55-34/h21-26H,1-20H2 |
| InChIKey | YGHCSXCGQORETM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 193.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|