C16H26O2S — CID 135274772
6a-methyl-3-(6-methyl-5-oxoheptyl)-3,3a,4,6-tetrahydro-1H-cyclopenta[c]thiophen-5-one (PubChem CID 135274772) has the molecular formula C16H26O2S and a molecular weight of 282.45 g/mol. Its IUPAC name is 6a-methyl-3-(6-methyl-5-oxoheptyl)-3,3a,4,6-tetrahydro-1H-cyclopenta[c]thiophen-5-one.
| Compound Name | 6a-methyl-3-(6-methyl-5-oxoheptyl)-3,3a,4,6-tetrahydro-1H-cyclopenta[c]thiophen-5-one |
|---|---|
| PubChem CID | 135274772 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 6a-methyl-3-(6-methyl-5-oxoheptyl)-3,3a,4,6-tetrahydro-1H-cyclopenta[c]thiophen-5-one |
| SMILES | CC(C)C(=O)CCCCC1SCC2(C)CC(=O)CC12 |
| InChI | InChI=1S/C16H26O2S/c1-11(2)14(18)6-4-5-7-15-13-8-12(17)9-16(13,3)10-19-15/h11,13,15H,4-10H2,1-3H3 |
| InChIKey | PEYCEDQIGMYNKV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|