C22H41F3N2O2 — CID 135275014
1-[1-[4-[(1-tert-butylpiperidin-4-yl)methoxy]-2-methylbutan-2-yl]piperidin-4-yl]-2,2,2-trifluoroethanol (PubChem CID 135275014) has the molecular formula C22H41F3N2O2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 1-[1-[4-[(1-tert-butylpiperidin-4-yl)methoxy]-2-methylbutan-2-yl]piperidin-4-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[1-[4-[(1-tert-butylpiperidin-4-yl)methoxy]-2-methylbutan-2-yl]piperidin-4-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 135275014 |
| Molecular Formula | C22H41F3N2O2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | 1-[1-[4-[(1-tert-butylpiperidin-4-yl)methoxy]-2-methylbutan-2-yl]piperidin-4-yl]-2,2,2-trifluoroethanol |
| SMILES | CC(C)(C)N1CCC(COCCC(C)(C)N2CCC(C(O)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C22H41F3N2O2/c1-20(2,3)26-11-6-17(7-12-26)16-29-15-10-21(4,5)27-13-8-18(9-14-27)19(28)22(23,24)25/h17-19,28H,6-16H2,1-5H3 |
| InChIKey | PKRKKJFJHYPXDZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|