About 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane
1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane (PubChem CID 135275016) has the molecular formula C20H38F2N2
and a molecular weight of 344.53 g/mol. Its IUPAC name is 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane.
Molecular Properties
| Compound Name | 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane |
| PubChem CID | 135275016 |
| Molecular Formula | C20H38F2N2 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.30 |
| IUPAC Name | 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane |
| SMILES | CC(C)(C)N1CCCC(CC(C)(C)N2CCCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C20H38F2N2/c1-18(2,3)23-12-6-8-17(9-14-23)16-19(4,5)24-13-7-10-20(21,22)11-15-24/h17H,6-16H2,1-5H3 |
| InChIKey | GMKGHTXRBVPSSM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane?
The IUPAC name of 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane (CID 135275016) is 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane.
What is the SMILES notation for 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane?
The canonical SMILES for 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane is CC(C)(C)N1CCCC(CC(C)(C)N2CCCC(F)(F)CC2)CC1.
What is the InChIKey of 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane?
The InChIKey is GMKGHTXRBVPSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38F2N2/c1-18(2,3)23-12-6-8-17(9-14-23)16-19(4,5)24-13-7-10-20(21,22)11-15-24/h17H,6-16H2,1-5H3.
What are the key properties of 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane?
1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane has a molecular weight of 344.53 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1-tert-butylazepan-4-yl)-2-methylpropan-2-yl]-4,4-difluoroazepane is sourced from PubChem (CID 135275016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).