About 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine
6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine (PubChem CID 135275545) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine |
| PubChem CID | 135275545 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine |
| SMILES | CCC1CC=CC(C#CC(C)(C)C)=N1 |
| InChI | InChI=1S/C13H19N/c1-5-11-7-6-8-12(14-11)9-10-13(2,3)4/h6,8,11H,5,7H2,1-4H3 |
| InChIKey | XSYDZMIFSWMFRY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine?
The IUPAC name of 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine (CID 135275545) is 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine.
What is the SMILES notation for 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine?
The canonical SMILES for 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine is CCC1CC=CC(C#CC(C)(C)C)=N1.
What is the InChIKey of 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine?
The InChIKey is XSYDZMIFSWMFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-5-11-7-6-8-12(14-11)9-10-13(2,3)4/h6,8,11H,5,7H2,1-4H3.
What are the key properties of 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine?
6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine has a molecular weight of 189.30 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine is sourced from PubChem (CID 135275545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).