About 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine
4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine (PubChem CID 135275565) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine.
Molecular Properties
| Compound Name | 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine |
| PubChem CID | 135275565 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine |
| SMILES | [H]/N=C/C1=C(N)CNC1 |
| InChI | InChI=1S/C5H9N3/c6-1-4-2-8-3-5(4)7/h1,6,8H,2-3,7H2/b6-1+ |
| InChIKey | NDHMNZMCPVRWCJ-LZCJLJQNSA-N |
| XLogP | -0.55 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine?
The IUPAC name of 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine (CID 135275565) is 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine.
What is the SMILES notation for 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine?
The canonical SMILES for 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine is [H]/N=C/C1=C(N)CNC1.
What is the InChIKey of 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine?
The InChIKey is NDHMNZMCPVRWCJ-LZCJLJQNSA-N. The full InChI is InChI=1S/C5H9N3/c6-1-4-2-8-3-5(4)7/h1,6,8H,2-3,7H2/b6-1+.
What are the key properties of 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine?
4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine has a molecular weight of 111.15 g/mol, XLogP of -0.55, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methanimidoyl-2,5-dihydro-1H-pyrrol-3-amine is sourced from PubChem (CID 135275565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).