About cyclohepta-2,7-diene-1,2-dicarbonitrile
cyclohepta-2,7-diene-1,2-dicarbonitrile (PubChem CID 135275572) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is cyclohepta-2,7-diene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | cyclohepta-2,7-diene-1,2-dicarbonitrile |
| PubChem CID | 135275572 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | cyclohepta-2,7-diene-1,2-dicarbonitrile |
| SMILES | N#CC1=CCCCC=C1C#N |
| InChI | InChI=1S/C9H8N2/c10-6-8-4-2-1-3-5-9(8)7-11/h4-5H,1-3H2 |
| InChIKey | WVHXLJKGNTVXKH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohepta-2,7-diene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta-2,7-diene-1,2-dicarbonitrile?
The IUPAC name of cyclohepta-2,7-diene-1,2-dicarbonitrile (CID 135275572) is cyclohepta-2,7-diene-1,2-dicarbonitrile.
What is the SMILES notation for cyclohepta-2,7-diene-1,2-dicarbonitrile?
The canonical SMILES for cyclohepta-2,7-diene-1,2-dicarbonitrile is N#CC1=CCCCC=C1C#N.
What is the InChIKey of cyclohepta-2,7-diene-1,2-dicarbonitrile?
The InChIKey is WVHXLJKGNTVXKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c10-6-8-4-2-1-3-5-9(8)7-11/h4-5H,1-3H2.
What are the key properties of cyclohepta-2,7-diene-1,2-dicarbonitrile?
cyclohepta-2,7-diene-1,2-dicarbonitrile has a molecular weight of 144.18 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta-2,7-diene-1,2-dicarbonitrile is sourced from PubChem (CID 135275572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).