About (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine
(2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine (PubChem CID 135275737) has the molecular formula C7H10ClNO
and a molecular weight of 159.62 g/mol. Its IUPAC name is (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine.
Molecular Properties
| Compound Name | (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine |
| PubChem CID | 135275737 |
| Molecular Formula | C7H10ClNO |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine |
| SMILES | C/C1=C(\Cl)CCC/C=N\O1 |
| InChI | InChI=1S/C7H10ClNO/c1-6-7(8)4-2-3-5-9-10-6/h5H,2-4H2,1H3/b7-6+,9-5- |
| InChIKey | RWMFAZYAQIITEJ-MTNQHGNXSA-N |
| XLogP | 2.64 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine?
The IUPAC name of (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine (CID 135275737) is (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine.
What is the SMILES notation for (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine?
The canonical SMILES for (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine is C/C1=C(\Cl)CCC/C=N\O1.
What is the InChIKey of (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine?
The InChIKey is RWMFAZYAQIITEJ-MTNQHGNXSA-N. The full InChI is InChI=1S/C7H10ClNO/c1-6-7(8)4-2-3-5-9-10-6/h5H,2-4H2,1H3/b7-6+,9-5-.
What are the key properties of (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine?
(2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine has a molecular weight of 159.62 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,7E)-7-chloro-8-methyl-5,6-dihydro-4H-oxazocine is sourced from PubChem (CID 135275737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).