C27H32N8O — CID 135276289
3-methyl-N-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]butanamide (PubChem CID 135276289) has the molecular formula C27H32N8O and a molecular weight of 484.61 g/mol. Its IUPAC name is 3-methyl-N-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]butanamide.
| Compound Name | 3-methyl-N-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]butanamide |
|---|---|
| PubChem CID | 135276289 |
| Molecular Formula | C27H32N8O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 3-methyl-N-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]butanamide |
| SMILES | Cc1nnc2c(NCCCCNC(=O)CC(C)C)nc3cc(-c4nc5ccccc5n4C)ccc3n12 |
| InChI | InChI=1S/C27H32N8O/c1-17(2)15-24(36)28-13-7-8-14-29-25-27-33-32-18(3)35(27)23-12-11-19(16-21(23)30-25)26-31-20-9-5-6-10-22(20)34(26)4/h5-6,9-12,16-17H,7-8,13-15H2,1-4H3,(H,28,36)(H,29,30) |
| InChIKey | MUYGRFFOEJZERZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|