About 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea
1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea (PubChem CID 135276370) has the molecular formula C7H11FN2O
and a molecular weight of 158.18 g/mol. Its IUPAC name is 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea |
| PubChem CID | 135276370 |
| Molecular Formula | C7H11FN2O |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea |
| SMILES | CNC(=O)N/C=C/C=C\CF |
| InChI | InChI=1S/C7H11FN2O/c1-9-7(11)10-6-4-2-3-5-8/h2-4,6H,5H2,1H3,(H2,9,10,11)/b3-2-,6-4+ |
| InChIKey | QYSKPDKZHURKBS-MGLVMYNNSA-N |
| XLogP | 0.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea?
The IUPAC name of 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea (CID 135276370) is 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea.
What is the SMILES notation for 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea?
The canonical SMILES for 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea is CNC(=O)N/C=C/C=C\CF.
What is the InChIKey of 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea?
The InChIKey is QYSKPDKZHURKBS-MGLVMYNNSA-N. The full InChI is InChI=1S/C7H11FN2O/c1-9-7(11)10-6-4-2-3-5-8/h2-4,6H,5H2,1H3,(H2,9,10,11)/b3-2-,6-4+.
What are the key properties of 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea?
1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea has a molecular weight of 158.18 g/mol, XLogP of 0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E,3Z)-5-fluoropenta-1,3-dienyl]-3-methylurea is sourced from PubChem (CID 135276370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).