C30H30N8O2 — CID 135276449
2-methoxy-N-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]benzamide (PubChem CID 135276449) has the molecular formula C30H30N8O2 and a molecular weight of 534.62 g/mol. Its IUPAC name is 2-methoxy-N-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]benzamide.
| Compound Name | 2-methoxy-N-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]benzamide |
|---|---|
| PubChem CID | 135276449 |
| Molecular Formula | C30H30N8O2 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 2-methoxy-N-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]benzamide |
| SMILES | COc1ccccc1C(=O)NCCCCNc1nc2cc(-c3nc4ccccc4n3C)ccc2n2c(C)nnc12 |
| InChI | InChI=1S/C30H30N8O2/c1-19-35-36-29-27(31-16-8-9-17-32-30(39)21-10-4-7-13-26(21)40-3)33-23-18-20(14-15-25(23)38(19)29)28-34-22-11-5-6-12-24(22)37(28)2/h4-7,10-15,18H,8-9,16-17H2,1-3H3,(H,31,33)(H,32,39) |
| InChIKey | UDGDTQZZXJICRK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|