C26H30F6N4O2 — CID 135276932
[(3R,6S)-6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-(1,2,4-triazol-4-yl)piperidin-3-yl]methanol (PubChem CID 135276932) has the molecular formula C26H30F6N4O2 and a molecular weight of 544.54 g/mol. Its IUPAC name is [(3R,6S)-6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-(1,2,4-triazol-4-yl)piperidin-3-yl]methanol.
| Compound Name | [(3R,6S)-6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-(1,2,4-triazol-4-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 135276932 |
| Molecular Formula | C26H30F6N4O2 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [(3R,6S)-6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-(1,2,4-triazol-4-yl)piperidin-3-yl]methanol |
| SMILES | C=C(/C=C\C=C/C)[C@]1(COC(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC[C@@](CO)(n2cnnc2)CN1 |
| InChI | InChI=1S/C26H30F6N4O2/c1-4-5-6-7-18(2)24(9-8-23(14-37,13-33-24)36-16-34-35-17-36)15-38-19(3)20-10-21(25(27,28)29)12-22(11-20)26(30,31)32/h4-7,10-12,16-17,19,33,37H,2,8-9,13-15H2,1,3H3/b5-4-,7-6-/t19?,23-,24-/m1/s1 |
| InChIKey | YXTFEAPSLYBSQP-AAEVMWBUSA-N |
| XLogP | 5.59 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|