C27H34F3N3O3 — CID 135276982
2,2-difluoro-3-[(1R,3R)-1-[5-[2-(3-fluoropropylamino)ethoxy]-2-methoxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol (PubChem CID 135276982) has the molecular formula C27H34F3N3O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is 2,2-difluoro-3-[(1R,3R)-1-[5-[2-(3-fluoropropylamino)ethoxy]-2-methoxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[(1R,3R)-1-[5-[2-(3-fluoropropylamino)ethoxy]-2-methoxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 135276982 |
| Molecular Formula | C27H34F3N3O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 2,2-difluoro-3-[(1R,3R)-1-[5-[2-(3-fluoropropylamino)ethoxy]-2-methoxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
| SMILES | COc1ccc(OCCNCCCF)cc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(F)(F)CO |
| InChI | InChI=1S/C27H34F3N3O3/c1-18-14-21-20-6-3-4-7-23(20)32-25(21)26(33(18)16-27(29,30)17-34)22-15-19(8-9-24(22)35-2)36-13-12-31-11-5-10-28/h3-4,6-9,15,18,26,31-32,34H,5,10-14,16-17H2,1-2H3/t18-,26-/m1/s1 |
| InChIKey | AQBZHJBCKSTPQK-WXTAPIANSA-N |
| XLogP | 4.47 |
| TPSA | 69.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|