C26H31F4N3O2 — CID 135277036
[4-[2-(3-fluoropropylamino)ethoxy]-2-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]methanol (PubChem CID 135277036) has the molecular formula C26H31F4N3O2 and a molecular weight of 493.55 g/mol. Its IUPAC name is [4-[2-(3-fluoropropylamino)ethoxy]-2-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]methanol.
| Compound Name | [4-[2-(3-fluoropropylamino)ethoxy]-2-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 135277036 |
| Molecular Formula | C26H31F4N3O2 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | [4-[2-(3-fluoropropylamino)ethoxy]-2-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]methanol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cc(OCCNCCCF)ccc2CO)N1CC(F)(F)F |
| InChI | InChI=1S/C26H31F4N3O2/c1-17-13-22-20-5-2-3-6-23(20)32-24(22)25(33(17)16-26(28,29)30)21-14-19(8-7-18(21)15-34)35-12-11-31-10-4-9-27/h2-3,5-8,14,17,25,31-32,34H,4,9-13,15-16H2,1H3/t17-,25-/m1/s1 |
| InChIKey | BZZLWUMRMDWPKU-CRICUBBOSA-N |
| XLogP | 4.89 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|