C24H29F4N5O — CID 135277052
3-fluoro-N-[2-[5-methyl-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-4-yl]oxyethyl]propan-1-amine (PubChem CID 135277052) has the molecular formula C24H29F4N5O and a molecular weight of 479.52 g/mol. Its IUPAC name is 3-fluoro-N-[2-[5-methyl-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-4-yl]oxyethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[5-methyl-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-4-yl]oxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 135277052 |
| Molecular Formula | C24H29F4N5O |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 3-fluoro-N-[2-[5-methyl-6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-4-yl]oxyethyl]propan-1-amine |
| SMILES | Cc1c(OCCNCCCF)ncnc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(F)(F)F |
| InChI | InChI=1S/C24H29F4N5O/c1-15-12-18-17-6-3-4-7-19(17)32-21(18)22(33(15)13-24(26,27)28)20-16(2)23(31-14-30-20)34-11-10-29-9-5-8-25/h3-4,6-7,14-15,22,29,32H,5,8-13H2,1-2H3/t15-,22-/m1/s1 |
| InChIKey | IELFPOQNITXXKS-IVZQSRNASA-N |
| XLogP | 4.49 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|