C20H16BrF5N2 — CID 135277089
(1R,3R)-1-(3-bromo-2,6-difluorophenyl)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 135277089) has the molecular formula C20H16BrF5N2 and a molecular weight of 459.26 g/mol. Its IUPAC name is (1R,3R)-1-(3-bromo-2,6-difluorophenyl)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(3-bromo-2,6-difluorophenyl)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 135277089 |
| Molecular Formula | C20H16BrF5N2 |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (1R,3R)-1-(3-bromo-2,6-difluorophenyl)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)ccc(Br)c2F)N1CC(F)(F)F |
| InChI | InChI=1S/C20H16BrF5N2/c1-10-8-12-11-4-2-3-5-15(11)27-18(12)19(28(10)9-20(24,25)26)16-14(22)7-6-13(21)17(16)23/h2-7,10,19,27H,8-9H2,1H3/t10-,19-/m1/s1 |
| InChIKey | RUUPHSIRTLSWMR-GIGQVBGESA-N |
| XLogP | 6.11 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|