C26H32F3N3O2 — CID 135277092
N-[2-[3-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methoxyphenoxy]ethyl]-3-fluoropropan-1-amine (PubChem CID 135277092) has the molecular formula C26H32F3N3O2 and a molecular weight of 475.56 g/mol. Its IUPAC name is N-[2-[3-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methoxyphenoxy]ethyl]-3-fluoropropan-1-amine.
| Compound Name | N-[2-[3-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methoxyphenoxy]ethyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 135277092 |
| Molecular Formula | C26H32F3N3O2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-[2-[3-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methoxyphenoxy]ethyl]-3-fluoropropan-1-amine |
| SMILES | COc1ccc(OCCNCCCF)cc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(F)F |
| InChI | InChI=1S/C26H32F3N3O2/c1-17-14-20-19-6-3-4-7-22(19)31-25(20)26(32(17)16-24(28)29)21-15-18(8-9-23(21)33-2)34-13-12-30-11-5-10-27/h3-4,6-9,15,17,24,26,30-31H,5,10-14,16H2,1-2H3/t17-,26-/m1/s1 |
| InChIKey | HLEVNGBZPKFBLQ-WGDIFIGCSA-N |
| XLogP | 5.11 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|