C28H35F2N3O3 — CID 135277138
3-fluoro-N-[2-[3-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methoxyphenoxy]ethyl]propan-1-amine (PubChem CID 135277138) has the molecular formula C28H35F2N3O3 and a molecular weight of 499.60 g/mol. Its IUPAC name is 3-fluoro-N-[2-[3-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methoxyphenoxy]ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[3-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methoxyphenoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 135277138 |
| Molecular Formula | C28H35F2N3O3 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 3-fluoro-N-[2-[3-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methoxyphenoxy]ethyl]propan-1-amine |
| SMILES | COc1c(OCCNCCCF)cccc1[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC1(F)COC1 |
| InChI | InChI=1S/C28H35F2N3O3/c1-19-15-22-20-7-3-4-9-23(20)32-25(22)26(33(19)16-28(30)17-35-18-28)21-8-5-10-24(27(21)34-2)36-14-13-31-12-6-11-29/h3-5,7-10,19,26,31-32H,6,11-18H2,1-2H3/t19-,26-/m1/s1 |
| InChIKey | HAOCZFGTCUQABN-NIYFSFCBSA-N |
| XLogP | 4.58 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|