C25H29F4N3O — CID 135277196
3-fluoro-N-[2-[3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine (PubChem CID 135277196) has the molecular formula C25H29F4N3O and a molecular weight of 463.52 g/mol. Its IUPAC name is 3-fluoro-N-[2-[3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 135277196 |
| Molecular Formula | C25H29F4N3O |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 3-fluoro-N-[2-[3-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]propan-1-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cccc(OCCNCCCF)c2)N1CC(F)(F)F |
| InChI | InChI=1S/C25H29F4N3O/c1-17-14-21-20-8-2-3-9-22(20)31-23(21)24(32(17)16-25(27,28)29)18-6-4-7-19(15-18)33-13-12-30-11-5-10-26/h2-4,6-9,15,17,24,30-31H,5,10-14,16H2,1H3/t17-,24-/m1/s1 |
| InChIKey | UZTVFIJYDQIRSV-MZNJEOGPSA-N |
| XLogP | 5.39 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|