C17H12F8S2 — CID 135277885
1-butan-2-ylsulfanyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene (PubChem CID 135277885) has the molecular formula C17H12F8S2 and a molecular weight of 432.40 g/mol. Its IUPAC name is 1-butan-2-ylsulfanyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene.
| Compound Name | 1-butan-2-ylsulfanyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene |
|---|---|
| PubChem CID | 135277885 |
| Molecular Formula | C17H12F8S2 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 1-butan-2-ylsulfanyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene |
| SMILES | CCC(C)Sc1c(F)c(F)c(-c2c(F)c(F)c(SC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C17H12F8S2/c1-4-5(2)27-17-14(24)10(20)7(11(21)15(17)25)6-8(18)12(22)16(26-3)13(23)9(6)19/h5H,4H2,1-3H3 |
| InChIKey | QBJOKYACBJQHSU-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|