C20H17F3N4O2 — CID 135277935
(3-methyl-1,2-oxazol-4-yl)-[[1-[[4-(trifluoromethyl)phenyl]methyl]indazol-3-yl]amino]methanol (PubChem CID 135277935) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-4-yl)-[[1-[[4-(trifluoromethyl)phenyl]methyl]indazol-3-yl]amino]methanol.
| Compound Name | (3-methyl-1,2-oxazol-4-yl)-[[1-[[4-(trifluoromethyl)phenyl]methyl]indazol-3-yl]amino]methanol |
|---|---|
| PubChem CID | 135277935 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (3-methyl-1,2-oxazol-4-yl)-[[1-[[4-(trifluoromethyl)phenyl]methyl]indazol-3-yl]amino]methanol |
| SMILES | Cc1nocc1C(O)Nc1nn(Cc2ccc(C(F)(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C20H17F3N4O2/c1-12-16(11-29-26-12)19(28)24-18-15-4-2-3-5-17(15)27(25-18)10-13-6-8-14(9-7-13)20(21,22)23/h2-9,11,19,28H,10H2,1H3,(H,24,25) |
| InChIKey | CZOVNMULIHHFER-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|