C18H22F4 — CID 135278061
(2E,4Z,7Z)-1,1,1-trifluoro-5-(1-fluoroprop-2-enyl)-2-methyl-7-prop-2-enylideneundeca-2,4,8-triene (PubChem CID 135278061) has the molecular formula C18H22F4 and a molecular weight of 314.37 g/mol. Its IUPAC name is (2E,4Z,7Z)-1,1,1-trifluoro-5-(1-fluoroprop-2-enyl)-2-methyl-7-prop-2-enylideneundeca-2,4,8-triene.
| Compound Name | (2E,4Z,7Z)-1,1,1-trifluoro-5-(1-fluoroprop-2-enyl)-2-methyl-7-prop-2-enylideneundeca-2,4,8-triene |
|---|---|
| PubChem CID | 135278061 |
| Molecular Formula | C18H22F4 |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2E,4Z,7Z)-1,1,1-trifluoro-5-(1-fluoroprop-2-enyl)-2-methyl-7-prop-2-enylideneundeca-2,4,8-triene |
| SMILES | C=C/C=C(\C=CCC)C/C(=C/C=C(\C)C(F)(F)F)C(F)C=C |
| InChI | InChI=1S/C18H22F4/c1-5-8-10-15(9-6-2)13-16(17(19)7-3)12-11-14(4)18(20,21)22/h6-12,17H,2-3,5,13H2,1,4H3/b10-8?,14-11+,15-9+,16-12- |
| InChIKey | CBUXYDRYTVTXEF-YOGOVMJNSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|