C18H26F3N — CID 135278113
(Z)-N-[(2Z,4E)-4-ethyl-9-(trifluoromethyl)undeca-2,4,8-trien-3-yl]but-2-en-1-imine (PubChem CID 135278113) has the molecular formula C18H26F3N and a molecular weight of 313.40 g/mol. Its IUPAC name is (Z)-N-[(2Z,4E)-4-ethyl-9-(trifluoromethyl)undeca-2,4,8-trien-3-yl]but-2-en-1-imine.
| Compound Name | (Z)-N-[(2Z,4E)-4-ethyl-9-(trifluoromethyl)undeca-2,4,8-trien-3-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 135278113 |
| Molecular Formula | C18H26F3N |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (Z)-N-[(2Z,4E)-4-ethyl-9-(trifluoromethyl)undeca-2,4,8-trien-3-yl]but-2-en-1-imine |
| SMILES | CC/C(=C\CCC=C(CC)C(F)(F)F)/C(=C/C)/N=C/C=C\C |
| InChI | InChI=1S/C18H26F3N/c1-5-9-14-22-17(8-4)15(6-2)12-10-11-13-16(7-3)18(19,20)21/h5,8-9,12-14H,6-7,10-11H2,1-4H3/b9-5-,15-12+,16-13?,17-8-,22-14? |
| InChIKey | MIUMOZBPQSNBQS-DBMZASOQSA-N |
| XLogP | 6.40 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | 463 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|