C25H27F2N7O2 — CID 135278555
(2E,4Z)-5-[[5-fluoro-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-yl]amino]-2-methyl-5-(methylideneamino)-1-(4-methylpiperazin-1-yl)penta-2,4-dien-1-one (PubChem CID 135278555) has the molecular formula C25H27F2N7O2 and a molecular weight of 495.53 g/mol. Its IUPAC name is (2E,4Z)-5-[[5-fluoro-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-yl]amino]-2-methyl-5-(methylideneamino)-1-(4-methylpiperazin-1-yl)penta-2,4-dien-1-one.
| Compound Name | (2E,4Z)-5-[[5-fluoro-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-yl]amino]-2-methyl-5-(methylideneamino)-1-(4-methylpiperazin-1-yl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 135278555 |
| Molecular Formula | C25H27F2N7O2 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | (2E,4Z)-5-[[5-fluoro-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-yl]amino]-2-methyl-5-(methylideneamino)-1-(4-methylpiperazin-1-yl)penta-2,4-dien-1-one |
| SMILES | C=N/C(=C\C=C(/C)C(=O)N1CCN(C)CC1)Nc1ncnc(Oc2ccc3[nH]c(C)cc3c2F)c1F |
| InChI | InChI=1S/C25H27F2N7O2/c1-15(25(35)34-11-9-33(4)10-12-34)5-8-20(28-3)32-23-22(27)24(30-14-29-23)36-19-7-6-18-17(21(19)26)13-16(2)31-18/h5-8,13-14,31H,3,9-12H2,1-2,4H3,(H,29,30,32)/b15-5+,20-8+ |
| InChIKey | HMUMJRFLQVRIRA-MTAPCYAASA-N |
| XLogP | 4.01 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|