C21H22F2N2O4S — CID 135278579
4-[2-[(3,3-difluorocyclobutyl)methoxy]-5-ethylsulfonylphenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine (PubChem CID 135278579) has the molecular formula C21H22F2N2O4S and a molecular weight of 436.48 g/mol. Its IUPAC name is 4-[2-[(3,3-difluorocyclobutyl)methoxy]-5-ethylsulfonylphenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 4-[2-[(3,3-difluorocyclobutyl)methoxy]-5-ethylsulfonylphenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 135278579 |
| Molecular Formula | C21H22F2N2O4S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-[2-[(3,3-difluorocyclobutyl)methoxy]-5-ethylsulfonylphenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine |
| SMILES | CCS(=O)(=O)c1ccc(OCC2CC(F)(F)C2)c(-c2cc(C)n(O)c3nccc2-3)c1 |
| InChI | InChI=1S/C21H22F2N2O4S/c1-3-30(27,28)15-4-5-19(29-12-14-10-21(22,23)11-14)18(9-15)17-8-13(2)25(26)20-16(17)6-7-24-20/h4-9,14,26H,3,10-12H2,1-2H3 |
| InChIKey | MYSVRABODJHMPZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|