C22H15F2N3O4S — CID 135278768
2-[4-(2,4-difluorophenoxy)-3-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonylacetonitrile (PubChem CID 135278768) has the molecular formula C22H15F2N3O4S and a molecular weight of 455.44 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenoxy)-3-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonylacetonitrile.
| Compound Name | 2-[4-(2,4-difluorophenoxy)-3-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonylacetonitrile |
|---|---|
| PubChem CID | 135278768 |
| Molecular Formula | C22H15F2N3O4S |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2-[4-(2,4-difluorophenoxy)-3-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonylacetonitrile |
| SMILES | Cc1cc(-c2cc(S(=O)(=O)CC#N)ccc2Oc2ccc(F)cc2F)c2ccnc-2n1O |
| InChI | InChI=1S/C22H15F2N3O4S/c1-13-10-17(16-6-8-26-22(16)27(13)28)18-12-15(32(29,30)9-7-25)3-5-20(18)31-21-4-2-14(23)11-19(21)24/h2-6,8,10-12,28H,9H2,1H3 |
| InChIKey | CLNPCTJOPHMBNX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|