C24H46N4 — CID 135278841
(1R,4R)-2-tert-butyl-5-[3-[(1S,4S)-5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,3-dimethylbutan-2-yl]-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 135278841) has the molecular formula C24H46N4 and a molecular weight of 390.66 g/mol. Its IUPAC name is (1R,4R)-2-tert-butyl-5-[3-[(1S,4S)-5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,3-dimethylbutan-2-yl]-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1R,4R)-2-tert-butyl-5-[3-[(1S,4S)-5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,3-dimethylbutan-2-yl]-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 135278841 |
| Molecular Formula | C24H46N4 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.37 |
| IUPAC Name | (1R,4R)-2-tert-butyl-5-[3-[(1S,4S)-5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,3-dimethylbutan-2-yl]-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)N1C[C@H]2C[C@@H]1CN2C(C)(C)C(C)(C)N1C[C@@H]2C[C@H]1CN2C(C)(C)C |
| InChI | InChI=1S/C24H46N4/c1-21(2,3)25-13-19-11-17(25)15-27(19)23(7,8)24(9,10)28-16-18-12-20(28)14-26(18)22(4,5)6/h17-20H,11-16H2,1-10H3/t17-,18+,19-,20+ |
| InChIKey | ZCKHJLFMOMICRN-FGYAAKKASA-N |
| XLogP | 3.66 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |