About (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite
(4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite (PubChem CID 135278873) has the molecular formula C8H6ClIN2S
and a molecular weight of 324.57 g/mol. Its IUPAC name is (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite.
Molecular Properties
| Compound Name | (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite |
| PubChem CID | 135278873 |
| Molecular Formula | C8H6ClIN2S |
| Molecular Weight | 324.57 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite |
| SMILES | Cc1cc(Cl)c2ccn(SI)c2n1 |
| InChI | InChI=1S/C8H6ClIN2S/c1-5-4-7(9)6-2-3-12(13-10)8(6)11-5/h2-4H,1H3 |
| InChIKey | UTDHEONDFZBGJI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite?
The IUPAC name of (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite (CID 135278873) is (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite.
What is the SMILES notation for (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite?
The canonical SMILES for (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite is Cc1cc(Cl)c2ccn(SI)c2n1.
What is the InChIKey of (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite?
The InChIKey is UTDHEONDFZBGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClIN2S/c1-5-4-7(9)6-2-3-12(13-10)8(6)11-5/h2-4H,1H3.
What are the key properties of (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite?
(4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite has a molecular weight of 324.57 g/mol, XLogP of 3.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-6-methylpyrrolo[2,3-b]pyridin-1-yl) thiohypoiodite is sourced from PubChem (CID 135278873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).