C25H48N4 — CID 135279010
(1S,4S)-2-tert-butyl-5-[4-[(1R,4R)-5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,4-dimethylpentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 135279010) has the molecular formula C25H48N4 and a molecular weight of 404.69 g/mol. Its IUPAC name is (1S,4S)-2-tert-butyl-5-[4-[(1R,4R)-5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,4-dimethylpentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-tert-butyl-5-[4-[(1R,4R)-5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,4-dimethylpentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 135279010 |
| Molecular Formula | C25H48N4 |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 404.39 |
| IUPAC Name | (1S,4S)-2-tert-butyl-5-[4-[(1R,4R)-5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,4-dimethylpentan-2-yl]-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)N1C[C@H]2C[C@@H]1CN2C(C)(C)CC(C)(C)N1C[C@@H]2C[C@H]1CN2C(C)(C)C |
| InChI | InChI=1S/C25H48N4/c1-22(2,3)26-13-20-11-18(26)15-28(20)24(7,8)17-25(9,10)29-16-19-12-21(29)14-27(19)23(4,5)6/h18-21H,11-17H2,1-10H3/t18-,19+,20-,21+ |
| InChIKey | NTHOZIWGIGJVCB-FXELSEDVSA-N |
| XLogP | 4.05 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |