C34H38N4O — CID 135279281
cis-(1S,2R)-2-[[7-[2-(3,3-dimethylcyclopenta-1,4-dien-1-yl)ethyl]-4-imino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-3-yl]methyl]cyclohexan-1-ol (PubChem CID 135279281) has the molecular formula C34H38N4O and a molecular weight of 518.71 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[7-[2-(3,3-dimethylcyclopenta-1,4-dien-1-yl)ethyl]-4-imino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-3-yl]methyl]cyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-[[7-[2-(3,3-dimethylcyclopenta-1,4-dien-1-yl)ethyl]-4-imino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-3-yl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 135279281 |
| Molecular Formula | C34H38N4O |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | cis-(1S,2R)-2-[[7-[2-(3,3-dimethylcyclopenta-1,4-dien-1-yl)ethyl]-4-imino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-3-yl]methyl]cyclohexan-1-ol |
| SMILES | [H]/N=c1/c2c(-c3ccccc3)c(-c3ccccc3)n(CCC3=CC(C)(C)C=C3)c2ncn1C[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C34H38N4O/c1-34(2)19-17-24(21-34)18-20-38-31(26-13-7-4-8-14-26)29(25-11-5-3-6-12-25)30-32(35)37(23-36-33(30)38)22-27-15-9-10-16-28(27)39/h3-8,11-14,17,19,21,23,27-28,35,39H,9-10,15-16,18,20,22H2,1-2H3/b35-32-/t27-,28+/m1/s1 |
| InChIKey | AFAZDYURFIMLPL-ZQMDSQIJSA-N |
| XLogP | 7.11 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |