C40H53N5O4 — CID 135280082
5-[4-[(4-butoxypiperidin-1-yl)methyl]phenyl]-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methyl-3-[(1-prop-2-enoylpiperidin-4-yl)amino]benzamide (PubChem CID 135280082) has the molecular formula C40H53N5O4 and a molecular weight of 667.90 g/mol. Its IUPAC name is 5-[4-[(4-butoxypiperidin-1-yl)methyl]phenyl]-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methyl-3-[(1-prop-2-enoylpiperidin-4-yl)amino]benzamide.
| Compound Name | 5-[4-[(4-butoxypiperidin-1-yl)methyl]phenyl]-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methyl-3-[(1-prop-2-enoylpiperidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 135280082 |
| Molecular Formula | C40H53N5O4 |
| Molecular Weight | 667.90 g/mol |
| Exact Mass | 667.41 |
| IUPAC Name | 5-[4-[(4-butoxypiperidin-1-yl)methyl]phenyl]-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methyl-3-[(1-prop-2-enoylpiperidin-4-yl)amino]benzamide |
| SMILES | C=CC(=O)N1CCC(Nc2cc(-c3ccc(CN4CCC(OCCCC)CC4)cc3)cc(C(=O)NCc3c(C)cc(C)[nH]c3=O)c2C)CC1 |
| InChI | InChI=1S/C40H53N5O4/c1-6-8-21-49-34-15-17-44(18-16-34)26-30-9-11-31(12-10-30)32-23-35(39(47)41-25-36-27(3)22-28(4)42-40(36)48)29(5)37(24-32)43-33-13-19-45(20-14-33)38(46)7-2/h7,9-12,22-24,33-34,43H,2,6,8,13-21,25-26H2,1,3-5H3,(H,41,47)(H,42,48) |
| InChIKey | DJFCPQWLZKTWME-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.90 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|