C22H28FN3O3 — CID 135280466
methyl (2E,4Z)-6-(3-fluoro-N-(1-methylpiperidine-4-carbonyl)anilino)-2-methyl-5-(methylideneamino)hexa-2,4-dienoate (PubChem CID 135280466) has the molecular formula C22H28FN3O3 and a molecular weight of 401.48 g/mol. Its IUPAC name is methyl (2E,4Z)-6-(3-fluoro-N-(1-methylpiperidine-4-carbonyl)anilino)-2-methyl-5-(methylideneamino)hexa-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-6-(3-fluoro-N-(1-methylpiperidine-4-carbonyl)anilino)-2-methyl-5-(methylideneamino)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 135280466 |
| Molecular Formula | C22H28FN3O3 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | methyl (2E,4Z)-6-(3-fluoro-N-(1-methylpiperidine-4-carbonyl)anilino)-2-methyl-5-(methylideneamino)hexa-2,4-dienoate |
| SMILES | C=N/C(=C\C=C(/C)C(=O)OC)CN(C(=O)C1CCN(C)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H28FN3O3/c1-16(22(28)29-4)8-9-19(24-2)15-26(20-7-5-6-18(23)14-20)21(27)17-10-12-25(3)13-11-17/h5-9,14,17H,2,10-13,15H2,1,3-4H3/b16-8+,19-9- |
| InChIKey | GZFTYWOHBKDZCD-CCFWOGRNSA-N |
| XLogP | 3.20 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|