C12H15NO2 — CID 135280590
3-(4-ethenylcyclohexa-1,5-dien-1-yl)-5,5-dimethyl-1,4,2-dioxazole (PubChem CID 135280590) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(4-ethenylcyclohexa-1,5-dien-1-yl)-5,5-dimethyl-1,4,2-dioxazole.
| Compound Name | 3-(4-ethenylcyclohexa-1,5-dien-1-yl)-5,5-dimethyl-1,4,2-dioxazole |
|---|---|
| PubChem CID | 135280590 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-(4-ethenylcyclohexa-1,5-dien-1-yl)-5,5-dimethyl-1,4,2-dioxazole |
| SMILES | C=CC1C=CC(C2=NOC(C)(C)O2)=CC1 |
| InChI | InChI=1S/C12H15NO2/c1-4-9-5-7-10(8-6-9)11-13-15-12(2,3)14-11/h4-5,7-9H,1,6H2,2-3H3 |
| InChIKey | NWMPSIDVZDTNLU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|